ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
851628-34-7 4-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]butanoic acid |
|
| Produkt-Name | 4-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]butanoic acid |
| Englischer Name | 4-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]butanoic acid;1,2,4-oxadiazole-5-butanoic acid, 3-(4-methylphenyl)-;4-[3-(4-Methylphenyl)-1,2,4-oxadiazol-5-yl]butanoic acid |
| Molekulare Formel | C13H14N2O3 |
| Molecular Weight | 246.2619 |
| InChl | InChI=1/C13H14N2O3/c1-9-5-7-10(8-6-9)13-14-11(18-15-13)3-2-4-12(16)17/h5-8H,2-4H2,1H3,(H,16,17) |
| CAS Registry Number | 851628-34-7 |
| Molecular Structure | ![]() |
| Dichte | 1.227g/cm3 |
| Siedepunkt | 457.4°C at 760 mmHg |
| Brechungsindex | 1.556 |
| Flammpunkt | 230.4°C |
| Dampfdruck | 3.7E-09mmHg at 25°C |
| MSDS | |