ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
86-16-8 4-(2,5-diethoxy-4-nitrophenyl)morpholine |
|
| Produkt-Name | 4-(2,5-diethoxy-4-nitrophenyl)morpholine |
| Englischer Name | 4-(2,5-diethoxy-4-nitrophenyl)morpholine;Morpholine, 4-(2,5-diethoxy-4-nitrophenyl)- |
| Molekulare Formel | C14H20N2O5 |
| Molecular Weight | 296.319 |
| InChl | InChI=1/C14H20N2O5/c1-3-20-13-10-12(16(17)18)14(21-4-2)9-11(13)15-5-7-19-8-6-15/h9-10H,3-8H2,1-2H3 |
| CAS Registry Number | 86-16-8 |
| EINECS | 201-653-6 |
| Molecular Structure | ![]() |
| Dichte | 1.206g/cm3 |
| Schmelzpunkt | 139-141℃ |
| Siedepunkt | 475.6°C at 760 mmHg |
| Brechungsindex | 1.541 |
| Flammpunkt | 241.4°C |
| Dampfdruck | 3.28E-09mmHg at 25°C |
| Gefahrensymbole | |
| Risk Codes | R36/37/38:; |
| Safety Beschreibung | S26||S37/39:; |
| MSDS | |