ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
86-25-9 N-Octyl-N-phenylanilin |
|
| Produkt-Name | N-Octyl-N-phenylanilin |
| Synonyme | N-Octyl-N-phenylanilin; Octyldiphenylamin |
| Englischer Name | N-octyl-N-phenylaniline;N-Octyl-N-phenylaniline;Octyl diphenylamine |
| Molekulare Formel | C20H27N |
| Molecular Weight | 281.4351 |
| InChl | InChI=1/C20H27N/c1-2-3-4-5-6-13-18-21(19-14-9-7-10-15-19)20-16-11-8-12-17-20/h7-12,14-17H,2-6,13,18H2,1H3 |
| CAS Registry Number | 86-25-9 |
| EINECS | 201-658-3 |
| Molecular Structure | ![]() |
| Dichte | 0.971g/cm3 |
| Siedepunkt | 395°C at 760 mmHg |
| Brechungsindex | 1.553 |
| Flammpunkt | 172.4°C |
| Dampfdruck | 1.9E-06mmHg at 25°C |
| MSDS | |