ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
87-22-9 Phenylethyl salicylate |
|
| Produkt-Name | Phenylethyl salicylate |
| Englischer Name | Phenylethyl salicylate;.beta.-Phenylethyl salicylate;2-Phenylethyl salicylate;87-22-9;Salicylic acid, phenethyl ester;Salicylic acid, phenethyl ester (8CI);2-phenylethyl 2-hydroxybenzoate |
| Molekulare Formel | C15H14O3 |
| Molecular Weight | 242.2699 |
| InChl | InChI=1/C15H14O3/c16-14-9-5-4-8-13(14)15(17)18-11-10-12-6-2-1-3-7-12/h1-9,16H,10-11H2 |
| CAS Registry Number | 87-22-9 |
| EINECS | 201-732-5 |
| Molecular Structure | ![]() |
| Dichte | 1.193g/cm3 |
| Siedepunkt | 377.9°C at 760 mmHg |
| Brechungsindex | 1.595 |
| Flammpunkt | 158.3°C |
| Dampfdruck | 2.99E-06mmHg at 25°C |
| MSDS | |