ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
871110-29-1 4-Ethyl-5-(4-methoxyphenyl)-3-(methylsulfanyl)-1-phenyl-1H-pyrazol |
|
| Produkt-Name | 4-Ethyl-5-(4-methoxyphenyl)-3-(methylsulfanyl)-1-phenyl-1H-pyrazol |
| Synonyme | 871110-29-1; |
| Englischer Name | 4-ethyl-5-(4-methoxyphenyl)-3-(methylsulfanyl)-1-phenyl-1H-pyrazole;871110-29-1 |
| Molekulare Formel | C19H20N2OS |
| Molecular Weight | 324.4399 |
| InChl | InChI=1/C19H20N2OS/c1-4-17-18(14-10-12-16(22-2)13-11-14)21(20-19(17)23-3)15-8-6-5-7-9-15/h5-13H,4H2,1-3H3 |
| CAS Registry Number | 871110-29-1 |
| Molecular Structure | ![]() |
| Dichte | 1.131g/cm3 |
| Siedepunkt | 488.049°C at 760 mmHg |
| Brechungsindex | 1.6 |
| Flammpunkt | 248.963°C |
| Dampfdruck | 0mmHg at 25°C |
| MSDS | |