ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
88-13-1 3-Thiophenecarboxylic acid |
|
| Produkt-Name | 3-Thiophenecarboxylic acid |
| Englischer Name | 3-Thiophenecarboxylic acid;3-Thenoic acid;Thiophene-3-carboxylic acid;AKOS B013976;AKOS 207-06;3-Thiophenezoic acid;3-THIOPHENIC ACID;BETA-THIOPHENIC ACID;B-THIOPHENIC ACID;thiophene-3-carboxylate |
| Molekulare Formel | C5H4O2S |
| Molecular Weight | 128.1491 |
| InChl | InChI=1/C5H4O2S/c6-5(7)4-1-2-8-3-4/h1-3H,(H,6,7) |
| CAS Registry Number | 88-13-1 |
| EINECS | 201-802-5 |
| Molecular Structure | ![]() |
| Dichte | 1.401g/cm3 |
| Schmelzpunkt | 137-141℃ |
| Siedepunkt | 271.1°C at 760 mmHg |
| Brechungsindex | 1.606 |
| Flammpunkt | 117.8°C |
| Wasserlöslichkeit | 4.3 g/L (25℃) |
| Dampfdruck | 0.00323mmHg at 25°C |
| Gefahrensymbole | |
| Risk Codes | 36/37/38:; |
| Safety Beschreibung | S24/25:; |
| MSDS | |