ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
89-79-2 Isopulegol |
|
| Produkt-Name | Isopulegol |
| Synonyme | ; 1-Methyl-4-isopropenylcyclohexan-3-ol; p-menth-8-en-3-ol; (1R,2S,5R)-5-methyl-2-(prop-1-en-2-yl)cyclohexanol; |
| Englischer Name | Isopulegol;1-Methyl-4-isopropenylcyclohexan-3-ol;p-menth-8-en-3-ol;(1R,2S,5R)-5-methyl-2-(prop-1-en-2-yl)cyclohexanol |
| Molekulare Formel | C10H18O |
| Molecular Weight | 154.2493 |
| InChl | InChI=1/C10H18O/c1-7(2)9-5-4-8(3)6-10(9)11/h8-11H,1,4-6H2,2-3H3/t8-,9+,10-/m1/s1 |
| CAS Registry Number | 89-79-2 |
| EINECS | 201-940-6 |
| Molecular Structure | ![]() |
| Dichte | 0.912g/cm3 |
| Siedepunkt | 197°C at 760 mmHg |
| Brechungsindex | 1.472 |
| Flammpunkt | 78.3°C |
| Dampfdruck | 0.0993mmHg at 25°C |
| Gefahrensymbole | |
| Risk Codes | R21/22##Harmful in contact with skin and if swallowed.:; |
| MSDS | |