ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
898766-11-5 4-(2,3-difluorphenyl)-4-oxo-butansäure |
|
| Produkt-Name | 4-(2,3-difluorphenyl)-4-oxo-butansäure |
| Englischer Name | 4-(2,3-difluorophenyl)-4-oxo-butanoic acid; |
| Molekulare Formel | C10H8F2O3 |
| Molecular Weight | 214.1655 |
| InChl | InChI=1/C10H8F2O3/c11-7-3-1-2-6(10(7)12)8(13)4-5-9(14)15/h1-3H,4-5H2,(H,14,15) |
| CAS Registry Number | 898766-11-5 |
| Molecular Structure | ![]() |
| Dichte | 1.363g/cm3 |
| Siedepunkt | 369.2°C at 760 mmHg |
| Brechungsindex | 1.511 |
| Flammpunkt | 177.1°C |
| Dampfdruck | 4.19E-06mmHg at 25°C |
| MSDS | |