ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
898780-29-5 4-[3-(3,5-dimethylphenyl)propanoyl]benzonitril |
|
| Produkt-Name | 4-[3-(3,5-dimethylphenyl)propanoyl]benzonitril |
| Englischer Name | 4-[3-(3,5-dimethylphenyl)propanoyl]benzonitrile; |
| Molekulare Formel | C18H17NO |
| Molecular Weight | 263.3337 |
| InChl | InChI=1/C18H17NO/c1-13-9-14(2)11-16(10-13)5-8-18(20)17-6-3-15(12-19)4-7-17/h3-4,6-7,9-11H,5,8H2,1-2H3 |
| CAS Registry Number | 898780-29-5 |
| Molecular Structure | ![]() |
| Dichte | 1.1g/cm3 |
| Siedepunkt | 451.6°C at 760 mmHg |
| Brechungsindex | 1.58 |
| Flammpunkt | 226.9°C |
| Dampfdruck | 2.4E-08mmHg at 25°C |
| MSDS | |