ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
91-48-5 alpha-Phenylcinnamic acid |
|
| Produkt-Name | alpha-Phenylcinnamic acid |
| Englischer Name | alpha-Phenylcinnamic acid;a-Phenyl-trans-cinnamic acid, Pract.;a-(Phenylmethylene)benzeneacetic acid, Pract.;Phenylcinnamicacid,98%;(2E)-2,3-diphenylprop-2-enoic acid;2,3-diphenylprop-2-enoic acid;(2Z)-2,3-diphenylprop-2-enoic acid;(2E)-2,3-diphenylprop-2-enoate;(2Z)-2,3-diphenylprop-2-enoate |
| Molekulare Formel | C15H11O2 |
| Molecular Weight | 223.2472 |
| InChl | InChI=1/C15H12O2/c16-15(17)14(13-9-5-2-6-10-13)11-12-7-3-1-4-8-12/h1-11H,(H,16,17)/p-1/b14-11- |
| CAS Registry Number | 91-48-5 |
| EINECS | 202-069-4 |
| Molecular Structure | ![]() |
| Schmelzpunkt | 171-175℃ |
| Siedepunkt | 336.6°C at 760 mmHg |
| Flammpunkt | 239.8°C |
| Dampfdruck | 4.35E-05mmHg at 25°C |
| Safety Beschreibung | S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |