ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
999-64-4 3-Bromooctane |
|
Produkt-Name | 3-Bromooctane |
Englischer Name | 3-Bromooctane;Octane, 3-bromo- |
Molekulare Formel | C8H17Br |
Molecular Weight | 193.1246 |
InChl | InChI=1/C8H17Br/c1-3-5-6-7-8(9)4-2/h8H,3-7H2,1-2H3 |
CAS Registry Number | 999-64-4 |
EINECS | 213-664-3 |
Molecular Structure | ![]() |
Dichte | 1.108g/cm3 |
Siedepunkt | 190.8°C at 760 mmHg |
Brechungsindex | 1.45 |
Flammpunkt | 56.1°C |
Dampfdruck | 0.739mmHg at 25°C |
Safety Beschreibung | S23##Do not inhale gas/fumes/vapour/spray.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |