ChemIndex - A free chemical CAS search databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
286-99-7 Cyclododecane epoxide |
|
| Chemical Name | Cyclododecane epoxide |
| Synonyms | Cyclododecane epoxide, mixture of cis andtrans isomers;Cyclododecene oxide (cis+trans);Cyclododecane oxide;Epoxy N-Dodecane;13-oxabicyclo[10.1.0]tridecane;(1R,12R)-13-oxabicyclo[10.1.0]tridecane;(1R,12S)-13-oxabicyclo[10.1.0]tridecane;(1S,12S)-13-oxabicyclo[10.1.0]tridecane |
| Molecular Formula | C12H22O |
| Molecular Weight | 182.3025 |
| InChl | InChI=1/C12H22O/c1-2-4-6-8-10-12-11(13-12)9-7-5-3-1/h11-12H,1-10H2/t11-,12-/m0/s1 |
| CAS Registry Number | 286-99-7 |
| EINECS | 206-012-4 |
| Molecular Structure | ![]() |
| Density | 0.899g/cm3 |
| Melting Point | -7℃ |
| Boiling Point | 237.4°C at 760 mmHg |
| Refractive Index | 1.455 |
| Flash Point | 82.2°C |
| Vapour Pressur | 0.0691mmHg at 25°C |
| Hazard Symbols | |
| Risk Codes | R38:; |
| Safety Description | S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |