ChemIndex - Ingyenes kémiai CAS adatbázisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
286-99-7 Cyclododecane epoxide |
|
| termék neve | Cyclododecane epoxide |
| Angol név | Cyclododecane epoxide;Cyclododecane epoxide, mixture of cis andtrans isomers;Cyclododecene oxide (cis+trans);Cyclododecane oxide;Epoxy N-Dodecane;13-oxabicyclo[10.1.0]tridecane;(1R,12R)-13-oxabicyclo[10.1.0]tridecane;(1R,12S)-13-oxabicyclo[10.1.0]tridecane;(1S,12S)-13-oxabicyclo[10.1.0]tridecane |
| MF | C12H22O |
| Molekulatömeg | 182.3025 |
| InChI | InChI=1/C12H22O/c1-2-4-6-8-10-12-11(13-12)9-7-5-3-1/h11-12H,1-10H2/t11-,12-/m0/s1 |
| CAS-szám | 286-99-7 |
| EINECS | 206-012-4 |
| Molekuláris szerkezete | ![]() |
| Sűrűség | 0.899g/cm3 |
| Olvadáspont | -7℃ |
| Forráspont | 237.4°C at 760 mmHg |
| Törésmutató | 1.455 |
| Gyulladáspont | 82.2°C |
| Gőznyomás | 0.0691mmHg at 25°C |
| Veszély szimbólumok | |
| Kockázatot kódok | R38:; |
| Biztonsági Leírás | S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |