ChemIndex - A free chemical CAS search databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
56-55-3 1,2-Benzanthracene | 
			    |
| Chemical Name | 1,2-Benzanthracene | 
| Synonyms | 1,2-benzanthrene;2,3-benzophenanthracene;2,3-benzophenanthrene;B(A)A;benz[a]anthracene;Benz[a]anthracene;Benzanthracene;benzanthrene;Benzo[a]anthracene;Benzo[b]phenanthrene;naphthanthracene;tetraphene | 
| Molecular Formula | C18H12 | 
| Molecular Weight | 228.2879 | 
| InChl | InChI=1/C18H12/c1-2-7-15-12-18-16(11-14(15)6-1)10-9-13-5-3-4-8-17(13)18/h1-12H | 
| CAS Registry Number | 56-55-3 | 
| EINECS | 200-280-6 | 
| Molecular Structure | ![]()  | 
			    
| Density | 1.19g/cm3 | 
| Melting Point | 158-161℃ | 
| Boiling Point | 436.7°C at 760 mmHg | 
| Refractive Index | 1.771 | 
| Flash Point | 209.1°C | 
| Water Solubility | 0.0000014 g/100 mL | 
| Vapour Pressur | 2.02E-07mmHg at 25°C | 
| Hazard Symbols | |
| Risk Codes | R45##May cause cancer.||R50/53##Very toxic to aquatic organisms, may cause long-term adverse effects in the aquatic environment.:; | 
			    
| Safety Description | S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).||S53##Avoid exposure - obtain special instructions before use.||S60##This material and its container must be disposed of as hazardous waste.||S61##Avoid release to the environment. Refer to special instructions / Safety data sheets.:; | 
			    
| MSDS | |