ChemIndex - A free chemical CAS search databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
82-83-7 puberulonic acid |
|
| Chemical Name | puberulonic acid |
| Synonyms | Puberulonic acid;1H-Cyclohepta(c)furan-1,2,4-trione, 5,6,7-trihydroxy- |
| Molecular Formula | C9H4O7 |
| Molecular Weight | 224.1239 |
| InChl | InChI=1/C9H4O7/c10-3-1-2-4(9(15)16-8(2)14)6(12)7(13)5(3)11/h1H,(H3,10,11,12,13) |
| CAS Registry Number | 82-83-7 |
| Molecular Structure | ![]() |
| Refractive Index | 1.756 |
| MSDS | |