ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
82-83-7 puberulonsyre |
|
| produktnavn | puberulonsyre |
| Synonymer | Puberulonsyre; 1H-cyklohepta(c)furan-1,2,4-trion, 5,6,7-trihydroksy- |
| Engelsk navn | puberulonic acid;Puberulonic acid;1H-Cyclohepta(c)furan-1,2,4-trione, 5,6,7-trihydroxy- |
| Molekylær Formel | C9H4O7 |
| Molekylvekt | 224.1239 |
| InChI | InChI=1/C9H4O7/c10-3-1-2-4(9(15)16-8(2)14)6(12)7(13)5(3)11/h1H,(H3,10,11,12,13) |
| CAS-nummer | 82-83-7 |
| Molecular Structure | ![]() |
| Brytningsindeks | 1.756 |
| MSDS | |