ChemIndex - A free chemical CAS search databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
84-66-2 Diethyl phthalate |
|
| Chemical Name | Diethyl phthalate |
| Synonyms | Ethyl phthalate;Diethyl phthalate, (Phthalic acid diethyl ester);Phthalic Acid Diethyl Ester;DIETHYLPHTALATE;Benzene-1,2-dicarboxylic acid diethyl ester;diethyl benzene-1,2-dicarboxylate;DEP;Diethyl phthalate (DEP) |
| Molecular Formula | C12H14O4 |
| Molecular Weight | 222.2372 |
| InChl | InChI:1S/C12H14O4/c1-3-15-11(13)9-7-5-6-8-10(9)12(14)16-4-2/h5-8H,3-4H2,1-2H3 |
| CAS Registry Number | 84-66-2 |
| EINECS | 201-550-6 |
| Molecular Structure | ![]() |
| Density | 1.121g/cm3 |
| Boiling Point | 294°C at 760 mmHg |
| Refractive Index | 1.507 |
| Flash Point | 155.8°C |
| Water Solubility | 1 g/L (20℃) |
| Vapour Pressur | 0.00167mmHg at 25°C |
| Safety Description | S24/25:; |
| MSDS | |