ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
84-66-2 Diethyl phthalate |
|
| Nome del prodotto | Diethyl phthalate |
| Nome inglese | Diethyl phthalate;Ethyl phthalate;Diethyl phthalate, (Phthalic acid diethyl ester);Phthalic Acid Diethyl Ester;DIETHYLPHTALATE;Benzene-1,2-dicarboxylic acid diethyl ester;diethyl benzene-1,2-dicarboxylate;DEP;Diethyl phthalate (DEP) |
| Formula molecolare | C12H14O4 |
| Peso Molecolare | 222.2372 |
| InChI | InChI:1S/C12H14O4/c1-3-15-11(13)9-7-5-6-8-10(9)12(14)16-4-2/h5-8H,3-4H2,1-2H3 |
| Numero CAS | 84-66-2 |
| EINECS | 201-550-6 |
| Struttura molecolare | ![]() |
| Densità | 1.121g/cm3 |
| Punto di ebollizione | 294°C at 760 mmHg |
| Indice di rifrazione | 1.507 |
| Punto d'infiammabilità | 155.8°C |
| Solubilità in acqua | 1 g/L (20℃) |
| Pressione di vapore | 0.00167mmHg at 25°C |
| Sicurezza Descrizione | S24/25:; |
| MSDS | |