ChemIndex - A free chemical CAS search databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
86-43-1 propoxycaine |
|
| Chemical Name | propoxycaine |
| Synonyms | 2-diethylaminoethyl 4-amino-2-propoxybenzoate |
| Molecular Formula | C16H26N2O3 |
| Molecular Weight | 294.3892 |
| InChl | InChI=1/C16H26N2O3/c1-4-10-20-15-12-13(17)7-8-14(15)16(19)21-11-9-18(5-2)6-3/h7-8,12H,4-6,9-11,17H2,1-3H3 |
| CAS Registry Number | 86-43-1 |
| EINECS | 201-670-9 |
| Molecular Structure | ![]() |
| Density | 1.065g/cm3 |
| Boiling Point | 434.4°C at 760 mmHg |
| Refractive Index | 1.527 |
| Flash Point | 216.5°C |
| Vapour Pressur | 9.5E-08mmHg at 25°C |
| MSDS | |