ChemIndex - Une base de données CAS chimique gratuiteToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
86-43-1 propoxycaine |
|
| Nom | propoxycaine |
| Nom anglais | propoxycaine;2-diethylaminoethyl 4-amino-2-propoxybenzoate |
| Formule moléculaire | C16H26N2O3 |
| Poids Moléculaire | 294.3892 |
| InChl | InChI=1/C16H26N2O3/c1-4-10-20-15-12-13(17)7-8-14(15)16(19)21-11-9-18(5-2)6-3/h7-8,12H,4-6,9-11,17H2,1-3H3 |
| Numéro de registre CAS | 86-43-1 |
| EINECS | 201-670-9 |
| Structure moléculaire | ![]() |
| Densité | 1.065g/cm3 |
| Point d'ébullition | 434.4°C at 760 mmHg |
| Indice de réfraction | 1.527 |
| Point d'éclair | 216.5°C |
| Pression de vapeur | 9.5E-08mmHg at 25°C |
| MSDS | |