ChemIndex - Una base de datos CAS gratuita de productos químicosToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
656821-29-3 1,4-Benzenediamine, N-(3-chloro-9-acridinyl)-N'-methyl- |
|
| Nombre del producto | 1,4-Benzenediamine, N-(3-chloro-9-acridinyl)-N'-methyl- |
| Nombre en inglés | 1,4-Benzenediamine, N-(3-chloro-9-acridinyl)-N'-methyl-; |
| Fórmula molecular | C20H16ClN3 |
| Número de registro CAS | 656821-29-3 |
| Estructura Molecular | ![]() |
| MSDS | |