ChemIndex - Una base de datos CAS gratuita de productos químicosToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
814-98-2 1,1,2,2-tetramethyldisilane |
|
| Nombre del producto | 1,1,2,2-tetramethyldisilane |
| Nombre en inglés | 1,1,2,2-tetramethyldisilane;Disilane, 1,1,2,2-tetramethyl- |
| Fórmula molecular | C4H12Si2 |
| Peso Molecular | 116.3091 |
| InChI | InChI=1/C4H12Si2/c1-5(2)6(3)4/h1-4H3 |
| Número de registro CAS | 814-98-2 |
| EINECS | 212-416-1 |
| Estructura Molecular | ![]() |
| MSDS | |