ChemIndex - Une base de données CAS chimique gratuiteToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
110011-49-9 3-méthyl-5-[3,5,7-trihydroxy-2-(4-hydroxyphényl)-4-oxo-4H-chromen-8-yl]pyrrolidine-2-one |
|
| Nom | 3-méthyl-5-[3,5,7-trihydroxy-2-(4-hydroxyphényl)-4-oxo-4H-chromen-8-yl]pyrrolidine-2-one |
| Nom anglais | 3-methyl-5-[3,5,7-trihydroxy-2-(4-hydroxyphenyl)-4-oxo-4H-chromen-8-yl]pyrrolidin-2-one; |
| Formule moléculaire | C20H17NO7 |
| Poids Moléculaire | 383.3515 |
| InChl | InChI=1/C20H17NO7/c1-8-6-11(21-20(8)27)14-12(23)7-13(24)15-16(25)17(26)18(28-19(14)15)9-2-4-10(22)5-3-9/h2-5,7-8,11,22-24,26H,6H2,1H3,(H,21,27) |
| Numéro de registre CAS | 110011-49-9 |
| Structure moléculaire | ![]() |
| Densité | 1.561g/cm3 |
| Point d'ébullition | 711.9°C at 760 mmHg |
| Indice de réfraction | 1.713 |
| Point d'éclair | 384.4°C |
| Pression de vapeur | 6.08E-21mmHg at 25°C |
| MSDS | |