ChemIndex - Une base de données CAS chimique gratuiteToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
112473-97-9 3-phénoxybenzyle 2-(hexyloxy)-3-méthylbutanoate |
|
| Nom | 3-phénoxybenzyle 2-(hexyloxy)-3-méthylbutanoate |
| Nom anglais | 3-phenoxybenzyl 2-(hexyloxy)-3-methylbutanoate; |
| Formule moléculaire | C24H32O4 |
| Poids Moléculaire | 384.5085 |
| InChl | InChI=1/C24H32O4/c1-4-5-6-10-16-26-23(19(2)3)24(25)27-18-20-12-11-15-22(17-20)28-21-13-8-7-9-14-21/h7-9,11-15,17,19,23H,4-6,10,16,18H2,1-3H3 |
| Numéro de registre CAS | 112473-97-9 |
| Structure moléculaire | ![]() |
| Densité | 1.043g/cm3 |
| Point d'ébullition | 487.6°C at 760 mmHg |
| Indice de réfraction | 1.519 |
| Point d'éclair | 208.3°C |
| Pression de vapeur | 1.17E-09mmHg at 25°C |
| MSDS | |