ChemIndex - Une base de données CAS chimique gratuiteToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
130061-81-3 3-hydroxy-10,11-dihydroquinidine |
|
| Nom | 3-hydroxy-10,11-dihydroquinidine |
| Nom anglais | 3-hydroxy-10,11-dihydroquinidine;Lnc 834;(9S)-10,11-Dihydro-6'-methoxycinchonan-3,9-diol;3-Hydroxy-10,11-dihydroquinidine;Lnc-834;Cinchonan-3,9-diol, 10,11-dihydro-6'-methoxy-, (9S)-, sulfate (1:1) (salt);(4beta,9S)-6'-methoxy-10,11-dihydrocinchonan-3,9-diol sulfate (salt) |
| Formule moléculaire | C20H28N2O7S |
| Poids Moléculaire | 440.5105 |
| InChl | InChI=1/C20H26N2O3.H2O4S/c1-3-20(24)12-22-9-7-13(20)10-18(22)19(23)15-6-8-21-17-5-4-14(25-2)11-16(15)17;1-5(2,3)4/h4-6,8,11,13,18-19,23-24H,3,7,9-10,12H2,1-2H3;(H2,1,2,3,4)/t13-,18-,19+,20-;/m1./s1 |
| Numéro de registre CAS | 130061-81-3 |
| Structure moléculaire | ![]() |
| Point d'ébullition | 536.3°C at 760 mmHg |
| Point d'éclair | 278.1°C |
| Pression de vapeur | 2.48E-12mmHg at 25°C |
| MSDS | |