ChemIndex - Une base de données CAS chimique gratuiteToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
167414-75-7 3-OXO-3-(1-CBZ-PIPERIDIN-4-YL)-PROPIONIC ACID ETHYL ESTER |
|
| Nom | 3-OXO-3-(1-CBZ-PIPERIDIN-4-YL)-PROPIONIC ACID ETHYL ESTER |
| Nom anglais | 3-OXO-3-(1-CBZ-PIPERIDIN-4-YL)-PROPIONIC ACID ETHYL ESTER;4-Piperidinepropanoic acid, beta-oxo-1-[(phenylmethoxy)carbonyl]-, ethyl ester;Benzyl 4-(3-ethoxy-3-oxopropanoyl)piperidine-1-carboxylate |
| Formule moléculaire | C18H23NO5 |
| Poids Moléculaire | 333.3789 |
| InChl | InChI=1/C18H23NO5/c1-2-23-17(21)12-16(20)15-8-10-19(11-9-15)18(22)24-13-14-6-4-3-5-7-14/h3-7,15H,2,8-13H2,1H3 |
| Numéro de registre CAS | 167414-75-7 |
| Structure moléculaire | ![]() |
| Densité | 1.19g/cm3 |
| Point d'ébullition | 461.782°C at 760 mmHg |
| Indice de réfraction | 1.533 |
| Point d'éclair | 233.078°C |
| Pression de vapeur | 0mmHg at 25°C |
| MSDS | |