ChemIndex - Une base de données CAS chimique gratuiteToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
214279-40-0 2-iodo-4-methoxy-1-nitrobenzene |
|
| Nom | 2-iodo-4-methoxy-1-nitrobenzene |
| Nom anglais | 2-iodo-4-methoxy-1-nitrobenzene;3-Iodo-4-nitroanisole |
| Formule moléculaire | C7H6INO3 |
| Poids Moléculaire | 279.0319 |
| InChl | InChI=1/C7H6INO3/c1-12-5-2-3-7(9(10)11)6(8)4-5/h2-4H,1H3 |
| Numéro de registre CAS | 214279-40-0 |
| Structure moléculaire | ![]() |
| Densité | 1.893g/cm3 |
| Point d'ébullition | 352.1°C at 760 mmHg |
| Indice de réfraction | 1.629 |
| Point d'éclair | 166.8°C |
| Pression de vapeur | 7.95E-05mmHg at 25°C |
| MSDS | |