ChemIndex - Une base de données CAS chimique gratuiteToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
230297-45-7 2-Tetrahydrofuranyl 5-norbornen-2-carboxylate |
|
| Nom | 2-Tetrahydrofuranyl 5-norbornen-2-carboxylate |
| Nom anglais | 2-Tetrahydrofuranyl 5-norbornen-2-carboxylate;2-Tetrahydrofuranyloxycarbonyl-5-norbornene;tetrahydrofuran-2-yl bicyclo[2.2.1]hept-5-ene-2-carboxylate |
| Formule moléculaire | C12H16O3 |
| Poids Moléculaire | 208.2536 |
| InChl | InChI=1/C12H16O3/c13-12(15-11-2-1-5-14-11)10-7-8-3-4-9(10)6-8/h3-4,8-11H,1-2,5-7H2 |
| Numéro de registre CAS | 230297-45-7 |
| Structure moléculaire | ![]() |
| Densité | 1.18g/cm3 |
| Point d'ébullition | 298.4°C at 760 mmHg |
| Indice de réfraction | 1.536 |
| Point d'éclair | 121.1°C |
| Pression de vapeur | 0.00127mmHg at 25°C |
| MSDS | |