ChemIndex - Une base de données CAS chimique gratuiteToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
26107-89-1 4,6,8-trihydroxy-9-oxo-9H-xanthène-1-yl bêta-D-glucopyranoside |
|
| Nom | 4,6,8-trihydroxy-9-oxo-9H-xanthène-1-yl bêta-D-glucopyranoside |
| Nom anglais | 4,6,8-trihydroxy-9-oxo-9H-xanthen-1-yl beta-D-glucopyranoside; |
| Formule moléculaire | C19H18O11 |
| Poids Moléculaire | 422.3396 |
| InChl | InChI=1/C19H18O11/c20-5-11-14(24)16(26)17(27)19(30-11)29-9-2-1-7(22)18-13(9)15(25)12-8(23)3-6(21)4-10(12)28-18/h1-4,11,14,16-17,19-24,26-27H,5H2/t11-,14-,16+,17-,19-/m1/s1 |
| Numéro de registre CAS | 26107-89-1;34472-02-1;54954-12-0 |
| Structure moléculaire | ![]() |
| Densité | 1.789g/cm3 |
| Point d'ébullition | 833.7°C at 760 mmHg |
| Indice de réfraction | 1.757 |
| Point d'éclair | 300.4°C |
| Pression de vapeur | 1.79E-29mmHg at 25°C |
| MSDS | |