ChemIndex - Une base de données CAS chimique gratuiteToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
3060-89-7 metobromuron |
|
| Nom | metobromuron |
| Nom anglais | metobromuron;3-p-bromophenyl-1-methoxy-1-methylurea;3-(4-bromophenyl)-1-methoxy-1-methylurea |
| Formule moléculaire | C9H11BrN2O2 |
| Poids Moléculaire | 259.0998 |
| InChl | InChI=1/C9H11BrN2O2/c1-12(14-2)9(13)11-8-5-3-7(10)4-6-8/h3-6H,1-2H3,(H,11,13) |
| Numéro de registre CAS | 3060-89-7 |
| EINECS | 221-301-5 |
| Structure moléculaire | ![]() |
| Densité | 1.534g/cm3 |
| Indice de réfraction | 1.607 |
| MSDS | |