ChemIndex - Une base de données CAS chimique gratuiteToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
3100-74-1 N-(2-chloro-5-éthylphényl)-4-(diéthylamino)butanamide |
|
| Nom | N-(2-chloro-5-éthylphényl)-4-(diéthylamino)butanamide |
| Nom anglais | N-(2-chloro-5-ethylphenyl)-4-(diethylamino)butanamide; |
| Formule moléculaire | C16H25ClN2O |
| Poids Moléculaire | 296.8355 |
| InChl | InChI=1/C16H25ClN2O/c1-4-13-9-10-14(17)15(12-13)18-16(20)8-7-11-19(5-2)6-3/h9-10,12H,4-8,11H2,1-3H3,(H,18,20) |
| Numéro de registre CAS | 3100-74-1 |
| Structure moléculaire | ![]() |
| Densité | 1.085g/cm3 |
| Point d'ébullition | 432.1°C at 760 mmHg |
| Indice de réfraction | 1.544 |
| Point d'éclair | 215.1°C |
| Pression de vapeur | 1.14E-07mmHg at 25°C |
| MSDS | |