ChemIndex - Une base de données CAS chimique gratuiteToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
343604-41-1 3',4'-difluorobiphényl-3-carbaldéhyde |
|
| Nom | 3',4'-difluorobiphényl-3-carbaldéhyde |
| Synonymes | ; [1,1'-biphényl]-3-carboxaldéhyde, 3',4'-difluorély- ; 3',4'-DIFLUOROBIPHÉNYL-3-CARBALDÉHYDE |
| Nom anglais | 3',4'-difluorobiphenyl-3-carbaldehyde;[1,1'-biphenyl]-3-carboxaldehyde, 3',4'-difluoro-;3',4'-DIFLUOROBIPHENYL-3-CARBALDEHYDE |
| Formule moléculaire | C13H8F2O |
| Poids Moléculaire | 218.1988 |
| InChl | InChI=1/C13H8F2O/c14-12-5-4-11(7-13(12)15)10-3-1-2-9(6-10)8-16/h1-8H |
| Numéro de registre CAS | 343604-41-1 |
| Structure moléculaire | ![]() |
| Densité | 1.248g/cm3 |
| Point d'ébullition | 331.779°C at 760 mmHg |
| Indice de réfraction | 1.573 |
| Point d'éclair | 127.189°C |
| Pression de vapeur | 0mmHg at 25°C |
| MSDS | |