ChemIndex - Une base de données CAS chimique gratuiteToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
344349-71-9 4-(Phenoxymethyl)phenylacetic acid |
|
| Nom | 4-(Phenoxymethyl)phenylacetic acid |
| Nom anglais | 4-(Phenoxymethyl)phenylacetic acid; |
| Formule moléculaire | C15H14O3 |
| Poids Moléculaire | 242.2699 |
| InChl | InChI=1/C15H14O3/c16-15(17)10-12-6-8-13(9-7-12)11-18-14-4-2-1-3-5-14/h1-9H,10-11H2,(H,16,17) |
| Numéro de registre CAS | 344349-71-9 |
| Structure moléculaire | ![]() |
| Densité | 1.201g/cm3 |
| Point d'ébullition | 415.7°C at 760 mmHg |
| Indice de réfraction | 1.595 |
| Point d'éclair | 157.1°C |
| Pression de vapeur | 1.18E-07mmHg at 25°C |
| MSDS | |