ChemIndex - Une base de données CAS chimique gratuiteToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
41330-24-9 3-méthylcyclopentane-1,2-diamine |
|
| Nom | 3-méthylcyclopentane-1,2-diamine |
| Synonymes | 3-méthylcyclopentane-1,2-diamine |
| Nom anglais | 3-methylcyclopentane-1,2-diamine;3-Methylcyclopentane-1,2-diamine |
| Formule moléculaire | C6H14N2 |
| Poids Moléculaire | 114.1888 |
| InChl | InChI=1/C6H14N2/c1-4-2-3-5(7)6(4)8/h4-6H,2-3,7-8H2,1H3 |
| Numéro de registre CAS | 41330-24-9 |
| EINECS | 255-317-9 |
| Structure moléculaire | ![]() |
| Densité | 0.922g/cm3 |
| Point d'ébullition | 169.3°C at 760 mmHg |
| Indice de réfraction | 1.475 |
| Point d'éclair | 63.3°C |
| Pression de vapeur | 1.55mmHg at 25°C |
| MSDS | |