ChemIndex - Une base de données CAS chimique gratuiteToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
461-57-4 1,1-difluoro-2-méthoxyéthane |
|
| Nom | 1,1-difluoro-2-méthoxyéthane |
| Synonymes | 1,1-difluoro-2-méthoxyéthane ; éther méthylique 2,2-difluoroéthyle ; éthane, 1,1-difluoro-2-méthoxy- ; |
| Nom anglais | 1,1-difluoro-2-methoxyethane;1,1-Difluoro-2-methoxyethane;2,2-Difluoroethyl methyl ether;ethane, 1,1-difluoro-2-methoxy- |
| Formule moléculaire | C3H6F2O |
| Poids Moléculaire | 96.0759 |
| InChl | InChI=1/C3H6F2O/c1-6-2-3(4)5/h3H,2H2,1H3 |
| Numéro de registre CAS | 461-57-4 |
| Structure moléculaire | ![]() |
| Densité | 1.004g/cm3 |
| Point d'ébullition | 27.711°C at 760 mmHg |
| Indice de réfraction | 1.302 |
| Point d'éclair | -24.851°C |
| Pression de vapeur | 689.901mmHg at 25°C |
| MSDS | |