ChemIndex - Une base de données CAS chimique gratuiteToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
51771-17-6 4-hydroxy-N'-(4-methoxybenzylidene)benzohydrazide |
|
| Nom | 4-hydroxy-N'-(4-methoxybenzylidene)benzohydrazide |
| Nom anglais | 4-hydroxy-N'-(4-methoxybenzylidene)benzohydrazide; |
| Formule moléculaire | C15H14N2O3 |
| Poids Moléculaire | 270.2833 |
| InChl | InChI=1/C15H14N2O3/c1-20-14-8-2-11(3-9-14)10-16-17-15(19)12-4-6-13(18)7-5-12/h2-10,18H,1H3,(H,17,19) |
| Numéro de registre CAS | 51771-17-6 |
| Structure moléculaire | ![]() |
| Densité | 1.19g/cm3 |
| Indice de réfraction | 1.581 |
| MSDS | |