ChemIndex - Une base de données CAS chimique gratuiteToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
520-45-6 Dehydroacetic acid |
|
| Nom | Dehydroacetic acid |
| Nom anglais | Dehydroacetic acid;2-Acetyl-5-hydroxy-3-oxo-4-hexenoic acid, delta-lactone;3-Acetyl-6-methyl-2,4-pyrandione;3-acetyl-6-methyl-2H-Pyran-2,4(3H)-dione;3-Acetyl-6-methyl-2-pyranone;DHAA;Pyran-2,4(3H)-dione, 3-acetyl-6-methyl- |
| Formule moléculaire | C8H8O4 |
| Poids Moléculaire | 168.1467 |
| InChl | InChI=1/C8H8O4/c1-4-3-6(10)7(5(2)9)8(11)12-4/h3,7H,1-2H3 |
| Numéro de registre CAS | 520-45-6;16807-48-0 |
| EINECS | 208-293-9 |
| Structure moléculaire | ![]() |
| Densité | 1.264g/cm3 |
| Point de fusion | 109-112℃ |
| Point d'ébullition | 332.6°C at 760 mmHg |
| Indice de réfraction | 1.489 |
| Point d'éclair | 150.5°C |
| Pression de vapeur | 0.000144mmHg at 25°C |
| Les symboles de danger | |
| Codes des risques | R22:; |
| MSDS | |