ChemIndex - Une base de données CAS chimique gratuiteToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
52896-88-5 4-éthyl-2-méthylheptane |
|
| Nom | 4-éthyl-2-méthylheptane |
| Synonymes | 4-éthyl-2-méthylheptane ; l’heptane, 4-éthyl-2-méthyl- ; |
| Nom anglais | 4-ethyl-2-methylheptane;4-Ethyl-2-methylheptane;heptane, 4-ethyl-2-methyl- |
| Formule moléculaire | C10H22 |
| Poids Moléculaire | 142.2817 |
| InChl | InChI=1/C10H22/c1-5-7-10(6-2)8-9(3)4/h9-10H,5-8H2,1-4H3 |
| Numéro de registre CAS | 52896-88-5 |
| Structure moléculaire | ![]() |
| Densité | 0.732g/cm3 |
| Point d'ébullition | 156°C at 760 mmHg |
| Indice de réfraction | 1.411 |
| Point d'éclair | 78°C |
| Pression de vapeur | 3.8mmHg at 25°C |
| MSDS | |