ChemIndex - Une base de données CAS chimique gratuiteToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
52897-01-5 4-éthyl-2,3-diméthylhexane |
|
| Nom | 4-éthyl-2,3-diméthylhexane |
| Synonymes | 4-éthyl-2,3-diméthylhexane ; Hexane, 3-éthyl-4,5-diméthyle ; hexane, 4-éthyl-2,3-diméthyl- ; |
| Nom anglais | 4-ethyl-2,3-dimethylhexane;4-Ethyl-2,3-dimethylhexane;Hexane, 3-ethyl-4,5-dimethyl;hexane, 4-ethyl-2,3-dimethyl- |
| Formule moléculaire | C10H22 |
| Poids Moléculaire | 142.2817 |
| InChl | InChI=1/C10H22/c1-6-10(7-2)9(5)8(3)4/h8-10H,6-7H2,1-5H3 |
| Numéro de registre CAS | 52897-01-5 |
| Structure moléculaire | ![]() |
| Densité | 0.73g/cm3 |
| Point d'ébullition | 161.2°C at 760 mmHg |
| Indice de réfraction | 1.41 |
| Point d'éclair | 43.6°C |
| Pression de vapeur | 3mmHg at 25°C |
| MSDS | |