ChemIndex - Une base de données CAS chimique gratuiteToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
53265-24-0 4-éthyl-2-méthyl-2H-pyrazino[2,3-b][1,4]thiazine-3(4H)-one |
|
| Nom | 4-éthyl-2-méthyl-2H-pyrazino[2,3-b][1,4]thiazine-3(4H)-one |
| Synonymes | ; |
| Nom anglais | 4-ethyl-2-methyl-2H-pyrazino[2,3-b][1,4]thiazin-3(4H)-one; |
| Formule moléculaire | C9H11N3OS |
| Poids Moléculaire | 209.2681 |
| InChl | InChI=1/C9H11N3OS/c1-3-12-7-8(11-5-4-10-7)14-6(2)9(12)13/h4-6H,3H2,1-2H3 |
| Numéro de registre CAS | 53265-24-0 |
| Structure moléculaire | ![]() |
| Densité | 1.25g/cm3 |
| Point d'ébullition | 433°C at 760 mmHg |
| Indice de réfraction | 1.582 |
| Point d'éclair | 215.7°C |
| Pression de vapeur | 1.06E-07mmHg at 25°C |
| MSDS | |