ChemIndex - Une base de données CAS chimique gratuiteToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
54254-58-9 5-(4-méthoxyphényl)-2,2-diméthyl-3-phényl-6-oxa-1-azabicyclo[3.1.0]hexane |
|
| Nom | 5-(4-méthoxyphényl)-2,2-diméthyl-3-phényl-6-oxa-1-azabicyclo[3.1.0]hexane |
| Nom anglais | 5-(4-methoxyphenyl)-2,2-dimethyl-3-phenyl-6-oxa-1-azabicyclo[3.1.0]hexane; |
| Formule moléculaire | C19H21NO2 |
| Poids Moléculaire | 295.3755 |
| InChl | InChI=1/C19H21NO2/c1-18(2)17(14-7-5-4-6-8-14)13-19(20(18)22-19)15-9-11-16(21-3)12-10-15/h4-12,17H,13H2,1-3H3 |
| Numéro de registre CAS | 54254-58-9 |
| Structure moléculaire | ![]() |
| Densité | 1.19g/cm3 |
| Point d'ébullition | 391.4°C at 760 mmHg |
| Indice de réfraction | 1.623 |
| Point d'éclair | 112.4°C |
| Pression de vapeur | 2.47E-06mmHg at 25°C |
| MSDS | |