ChemIndex - Une base de données CAS chimique gratuiteToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
56705-86-3 4-(3-methoxyphenoxy)aniline |
|
| Nom | 4-(3-methoxyphenoxy)aniline |
| Nom anglais | 4-(3-methoxyphenoxy)aniline;benzenamine, 4-(3-methoxyphenoxy)- |
| Formule moléculaire | C13H13NO2 |
| Poids Moléculaire | 215.2478 |
| InChl | InChI=1/C13H13NO2/c1-15-12-3-2-4-13(9-12)16-11-7-5-10(14)6-8-11/h2-9H,14H2,1H3 |
| Numéro de registre CAS | 56705-86-3 |
| Structure moléculaire | ![]() |
| Densité | 1.155g/cm3 |
| Point d'ébullition | 358.2°C at 760 mmHg |
| Indice de réfraction | 1.598 |
| Point d'éclair | 187.2°C |
| Pression de vapeur | 2.58E-05mmHg at 25°C |
| MSDS | |