ChemIndex - Une base de données CAS chimique gratuiteToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
56740-71-7 4,4-diphénylbutan-1-ol |
|
| Nom | 4,4-diphénylbutan-1-ol |
| Synonymes | 4,4-diphénylbutan-1-ol |
| Nom anglais | 4,4-diphenylbutan-1-ol;4,4-Diphenylbutan-1-ol |
| Formule moléculaire | C16H18O |
| Poids Moléculaire | 226.3135 |
| InChl | InChI=1/C16H18O/c17-13-7-12-16(14-8-3-1-4-9-14)15-10-5-2-6-11-15/h1-6,8-11,16-17H,7,12-13H2 |
| Numéro de registre CAS | 56740-71-7 |
| EINECS | 260-360-1 |
| Structure moléculaire | ![]() |
| Densité | 1.044g/cm3 |
| Point d'ébullition | 375.8°C at 760 mmHg |
| Indice de réfraction | 1.569 |
| Point d'éclair | 155.9°C |
| Pression de vapeur | 2.57E-06mmHg at 25°C |
| MSDS | |