ChemIndex - Une base de données CAS chimique gratuiteToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
5790-05-6 (4E)-5-(2,4-dimethoxyphenyl)-4-[hydroxy(4-methylphenyl)methylidene]-1-methylpyrrolidine-2,3-dione |
|
| Nom | (4E)-5-(2,4-dimethoxyphenyl)-4-[hydroxy(4-methylphenyl)methylidene]-1-methylpyrrolidine-2,3-dione |
| Nom anglais | (4E)-5-(2,4-dimethoxyphenyl)-4-[hydroxy(4-methylphenyl)methylidene]-1-methylpyrrolidine-2,3-dione; |
| Formule moléculaire | C21H21NO5 |
| Poids Moléculaire | 367.3951 |
| InChl | InChI=1/C21H21NO5/c1-12-5-7-13(8-6-12)19(23)17-18(22(2)21(25)20(17)24)15-10-9-14(26-3)11-16(15)27-4/h5-11,18,23H,1-4H3/b19-17+ |
| Numéro de registre CAS | 5790-05-6 |
| Structure moléculaire | ![]() |
| Densité | 1.267g/cm3 |
| Point d'ébullition | 546.1°C at 760 mmHg |
| Indice de réfraction | 1.609 |
| Point d'éclair | 284.1°C |
| Pression de vapeur | 9.25E-13mmHg at 25°C |
| MSDS | |