ChemIndex - Une base de données CAS chimique gratuiteToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
57950-59-1 4-nitrophényle 6-[(2-méthylacryloyl)amino]hexanoate |
|
| Nom | 4-nitrophényle 6-[(2-méthylacryloyl)amino]hexanoate |
| Synonymes | ; |
| Nom anglais | 4-nitrophenyl 6-[(2-methylacryloyl)amino]hexanoate; |
| Formule moléculaire | C16H20N2O5 |
| Poids Moléculaire | 320.3404 |
| InChl | InChI=1/C16H20N2O5/c1-12(2)16(20)17-11-5-3-4-6-15(19)23-14-9-7-13(8-10-14)18(21)22/h7-10H,1,3-6,11H2,2H3,(H,17,20) |
| Numéro de registre CAS | 57950-59-1 |
| Structure moléculaire | ![]() |
| Densité | 1.178g/cm3 |
| Point d'ébullition | 540.3°C at 760 mmHg |
| Indice de réfraction | 1.533 |
| Point d'éclair | 280.5°C |
| Pression de vapeur | 9.72E-12mmHg at 25°C |
| MSDS | |