ChemIndex - Une base de données CAS chimique gratuiteToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
58349-23-8 (S)-5-Methoxy-1,2,3,4-tetrahydro-N-(phenylmethyl)-2-naphthalenamine |
|
| Nom | (S)-5-Methoxy-1,2,3,4-tetrahydro-N-(phenylmethyl)-2-naphthalenamine |
| Nom anglais | (S)-5-Methoxy-1,2,3,4-tetrahydro-N-(phenylmethyl)-2-naphthalenamine;(S)-5-Methoxy-1,2,3,4-Tetrahydro-N-(Phenylmethyl)-2-Naphthalenamine (Rotigotine) |
| Formule moléculaire | C18H21NO |
| Poids Moléculaire | 267.37 |
| InChl | InChI=1/C18H21NO/c1-20-18-9-5-8-15-12-16(10-11-17(15)18)19-13-14-6-3-2-4-7-14/h2-9,16,19H,10-13H2,1H3/t16-/m0/s1 |
| Numéro de registre CAS | 58349-23-8 |
| Structure moléculaire | ![]() |
| Indice de réfraction | 1.593 |
| MSDS | |