ChemIndex - Une base de données CAS chimique gratuiteToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
59454-35-2 4'-decyl[1,1'-biphenyl]-4-carbonitrile |
|
| Nom | 4'-decyl[1,1'-biphenyl]-4-carbonitrile |
| Nom anglais | 4'-decyl[1,1'-biphenyl]-4-carbonitrile;(1,1'-Biphenyl)-4-carbonitrile, 4'-decyl-;4-Cyano-4'-decylbiphenyl;4'-Decyl(1,1'-biphenyl)-4-carbonitrile;4'-decylbiphenyl-4-carbonitrile;4'-decyl-4'-cyanobiphenyl |
| Formule moléculaire | C23H29N |
| Poids Moléculaire | 319.4831 |
| InChl | InChI=1/C23H29N/c1-2-3-4-5-6-7-8-9-10-20-11-15-22(16-12-20)23-17-13-21(19-24)14-18-23/h11-18H,2-10H2,1H3 |
| Numéro de registre CAS | 59454-35-2 |
| EINECS | 261-770-3 |
| Structure moléculaire | ![]() |
| Densité | 0.99g/cm3 |
| Point d'ébullition | 459.5°C at 760 mmHg |
| Indice de réfraction | 1.547 |
| Point d'éclair | 233.4°C |
| Pression de vapeur | 1.26E-08mmHg at 25°C |
| MSDS | |