ChemIndex - Une base de données CAS chimique gratuiteToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
74714-07-1 propan-2-yl oct-2-ynoate |
|
| Nom | propan-2-yl oct-2-ynoate |
| Nom anglais | propan-2-yl oct-2-ynoate; |
| Formule moléculaire | C11H18O2 |
| Poids Moléculaire | 182.2594 |
| InChl | InChI=1/C11H18O2/c1-4-5-6-7-8-9-11(12)13-10(2)3/h10H,4-7H2,1-3H3 |
| Numéro de registre CAS | 74714-07-1 |
| Structure moléculaire | ![]() |
| Densité | 0.923g/cm3 |
| Point d'ébullition | 256.9°C at 760 mmHg |
| Indice de réfraction | 1.447 |
| Point d'éclair | 102.1°C |
| Pression de vapeur | 0.015mmHg at 25°C |
| MSDS | |