ChemIndex - Une base de données CAS chimique gratuiteToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
76265-65-1 N-méthyl-N-[(7S)-1,2,3,9-tétraméthoxy-10-oxo-5,6,7,10-tétrahydrobenzo[a]heptalène-7-yl]formamide |
|
| Nom | N-méthyl-N-[(7S)-1,2,3,9-tétraméthoxy-10-oxo-5,6,7,10-tétrahydrobenzo[a]heptalène-7-yl]formamide |
| Synonymes | ; formamide, N-méthyl-N-[(7S)-5,6,7,10-tétrahydro-1,2,3,9-tétraméthoxy-10-oxobenzo[a]heptalène-7-yl]- ; |
| Nom anglais | N-methyl-N-[(7S)-1,2,3,9-tetramethoxy-10-oxo-5,6,7,10-tetrahydrobenzo[a]heptalen-7-yl]formamide;formamide, N-methyl-N-[(7S)-5,6,7,10-tetrahydro-1,2,3,9-tetramethoxy-10-oxobenzo[a]heptalen-7-yl]- |
| Formule moléculaire | C22H25NO6 |
| Poids Moléculaire | 399.437 |
| InChl | InChI=1/C22H25NO6/c1-23(12-24)16-8-6-13-10-19(27-3)21(28-4)22(29-5)20(13)14-7-9-17(25)18(26-2)11-15(14)16/h7,9-12,16H,6,8H2,1-5H3/t16-/m0/s1 |
| Numéro de registre CAS | 76265-65-1 |
| Structure moléculaire | ![]() |
| Densité | 1.25g/cm3 |
| Point d'ébullition | 705.1°C at 760 mmHg |
| Indice de réfraction | 1.59 |
| Point d'éclair | 380.2°C |
| Pression de vapeur | 9.98E-20mmHg at 25°C |
| MSDS | |