ChemIndex - Une base de données CAS chimique gratuiteToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
81-81-2 warfarin |
|
| Nom | warfarin |
| Nom anglais | warfarin;3-(A-acetonylbenzyl)4-hydroxycoumarin;4-hydroxy-3-(3-oxo-1-phenylbutyl)coumarin |
| Formule moléculaire | C19H16O4 |
| Poids Moléculaire | 308.33 |
| InChl | InChI=1/C19H16O4/c1-12(20)11-15(13-7-3-2-4-8-13)17-18(21)14-9-5-6-10-16(14)23-19(17)22/h2-10,15,21H,11H2,1H3 |
| Numéro de registre CAS | 81-81-2 |
| EINECS | 201-377-6 |
| Structure moléculaire | ![]() |
| Point de fusion | 162-164℃ |
| Point d'ébullition | 356℃ |
| solubilité dans l'eau | Practically insoluble |
| Les symboles de danger | |
| Codes des risques | R61||R48/25||R52/53:; |
| Description de sécurité | S52||S45||S61:; |
| MSDS | |